Pristinamycin IA

Pristinamycin IA

Other names Mikamycin B; Mikamycin IA; NSC 92554; PA 114B; Pristinamycin P 1; Streptogramin B; Vernamycin B
Identifiers
CAS number	3131-03-1
PubChem	14974
Jmol-3D images	Image 1
SMILES O=C([C@H](CC2=CC=C(N(C)C)C=C2)N(C)[C@]([C@H]6N(CCC6)C5=O)=O)N1[C@H]([C@](N[C@H](C(O[C@H](C)[C@@H](C(N[C@@H]5CC)=O)NC(C4=NC=CC=C4O)=O)=O)[C@]3=CC=CC=C3)=O)CC(CC1)=O
Properties
Molecular formula	C₄₅H₅₄N₈O₁₀
Molar mass	866.96 g/mol
Y (verify) (what is: Y/N?) Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa)
Infobox references

Pristinamycin IA (Mikamycin B) is an antibiotic cyclic peptide. It is a member of the streptogramin B group of antibiotics and one component of pristinamycin (the other being pristinamycin IIA).